About 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine
3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine (PubChem CID 67812852) has the molecular formula C6H9F3N2S
and a molecular weight of 198.21 g/mol. Its IUPAC name is 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine.
Molecular Properties
| Compound Name | 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine |
| PubChem CID | 67812852 |
| Molecular Formula | C6H9F3N2S |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine |
| SMILES | [H]/N=C1\SCCN1CCC(F)(F)F |
| InChI | InChI=1S/C6H9F3N2S/c7-6(8,9)1-2-11-3-4-12-5(11)10/h10H,1-4H2/b10-5- |
| InChIKey | XTSMZGKXVYVCEL-YHYXMXQVSA-N |
| XLogP | 1.92 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine?
The IUPAC name of 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine (CID 67812852) is 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine.
What is the SMILES notation for 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine?
The canonical SMILES for 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine is [H]/N=C1\SCCN1CCC(F)(F)F.
What is the InChIKey of 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine?
The InChIKey is XTSMZGKXVYVCEL-YHYXMXQVSA-N. The full InChI is InChI=1S/C6H9F3N2S/c7-6(8,9)1-2-11-3-4-12-5(11)10/h10H,1-4H2/b10-5-.
What are the key properties of 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine?
3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine has a molecular weight of 198.21 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3,3-trifluoropropyl)-1,3-thiazolidin-2-imine is sourced from PubChem (CID 67812852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).