C32H49N3O — CID 67813603
1-[(3R,5R)-5-[bis(4-tert-butylphenyl)methyl]pyrrolidin-3-yl]-1,3-di(propan-2-yl)urea (PubChem CID 67813603) has the molecular formula C32H49N3O and a molecular weight of 491.76 g/mol. Its IUPAC name is 1-[(3R,5R)-5-[bis(4-tert-butylphenyl)methyl]pyrrolidin-3-yl]-1,3-di(propan-2-yl)urea.
| Compound Name | 1-[(3R,5R)-5-[bis(4-tert-butylphenyl)methyl]pyrrolidin-3-yl]-1,3-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 67813603 |
| Molecular Formula | C32H49N3O |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.39 |
| IUPAC Name | 1-[(3R,5R)-5-[bis(4-tert-butylphenyl)methyl]pyrrolidin-3-yl]-1,3-di(propan-2-yl)urea |
| SMILES | CC(C)NC(=O)N(C(C)C)[C@H]1CN[C@@H](C(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C32H49N3O/c1-21(2)34-30(36)35(22(3)4)27-19-28(33-20-27)29(23-11-15-25(16-12-23)31(5,6)7)24-13-17-26(18-14-24)32(8,9)10/h11-18,21-22,27-29,33H,19-20H2,1-10H3,(H,34,36)/t27-,28-/m1/s1 |
| InChIKey | BWHMIZICEFPXSM-VSGBNLITSA-N |
| XLogP | 6.97 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |