About 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol
2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol (PubChem CID 67813640) has the molecular formula C18H23NO
and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol.
Molecular Properties
| Compound Name | 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol |
| PubChem CID | 67813640 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1cc(O)c(N(CC=C)CC=C)cc1CC=C |
| InChI | InChI=1S/C18H23NO/c1-5-9-15-13-17(19(11-7-3)12-8-4)18(20)14-16(15)10-6-2/h5-8,13-14,20H,1-4,9-12H2 |
| InChIKey | ZTZYYCQFEUOVFF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol?
The IUPAC name of 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol (CID 67813640) is 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol.
What is the SMILES notation for 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol?
The canonical SMILES for 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol is C=CCc1cc(O)c(N(CC=C)CC=C)cc1CC=C.
What is the InChIKey of 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol?
The InChIKey is ZTZYYCQFEUOVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO/c1-5-9-15-13-17(19(11-7-3)12-8-4)18(20)14-16(15)10-6-2/h5-8,13-14,20H,1-4,9-12H2.
What are the key properties of 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol?
2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol has a molecular weight of 269.39 g/mol, XLogP of 4.03, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(prop-2-enyl)amino]-4,5-bis(prop-2-enyl)phenol is sourced from PubChem (CID 67813640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).