About methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate
methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate (PubChem CID 67813915) has the molecular formula C31H28O6
and a molecular weight of 496.56 g/mol. Its IUPAC name is methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate.
Molecular Properties
| Compound Name | methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate |
| PubChem CID | 67813915 |
| Molecular Formula | C31H28O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate |
| SMILES | CCOc1c(C(=O)OC)c2c(c3ccccc13)OC(c1ccc(OC)cc1)(c1ccc(OC)cc1)C=C2 |
| InChI | InChI=1S/C31H28O6/c1-5-36-29-25-9-7-6-8-24(25)28-26(27(29)30(32)35-4)18-19-31(37-28,20-10-14-22(33-2)15-11-20)21-12-16-23(34-3)17-13-21/h6-19H,5H2,1-4H3 |
| InChIKey | YHSHSLJMBDEFCN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
The IUPAC name of methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate (CID 67813915) is methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate.
What is the SMILES notation for methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
The canonical SMILES for methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate is CCOc1c(C(=O)OC)c2c(c3ccccc13)OC(c1ccc(OC)cc1)(c1ccc(OC)cc1)C=C2.
What is the InChIKey of methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
The InChIKey is YHSHSLJMBDEFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H28O6/c1-5-36-29-25-9-7-6-8-24(25)28-26(27(29)30(32)35-4)18-19-31(37-28,20-10-14-22(33-2)15-11-20)21-12-16-23(34-3)17-13-21/h6-19H,5H2,1-4H3.
What are the key properties of methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate has a molecular weight of 496.56 g/mol, XLogP of 6.39, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-ethoxy-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate is sourced from PubChem (CID 67813915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).