C19H27N3O2 — CID 67813975
[2,6-ditert-butyl-4-(1H-pyrazol-4-ylamino)phenyl] acetate (PubChem CID 67813975) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-(1H-pyrazol-4-ylamino)phenyl] acetate.
| Compound Name | [2,6-ditert-butyl-4-(1H-pyrazol-4-ylamino)phenyl] acetate |
|---|---|
| PubChem CID | 67813975 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | [2,6-ditert-butyl-4-(1H-pyrazol-4-ylamino)phenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc(Nc2cn[nH]c2)cc1C(C)(C)C |
| InChI | InChI=1S/C19H27N3O2/c1-12(23)24-17-15(18(2,3)4)8-13(9-16(17)19(5,6)7)22-14-10-20-21-11-14/h8-11,22H,1-7H3,(H,20,21) |
| InChIKey | HVEQLCRWAXQCSR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|