C8H9N3S3 — CID 67814179
aniline;1,3,4-thiadiazolidine-2,5-dithione (PubChem CID 67814179) has the molecular formula C8H9N3S3 and a molecular weight of 243.38 g/mol. Its IUPAC name is aniline;1,3,4-thiadiazolidine-2,5-dithione.
| Compound Name | aniline;1,3,4-thiadiazolidine-2,5-dithione |
|---|---|
| PubChem CID | 67814179 |
| Molecular Formula | C8H9N3S3 |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | aniline;1,3,4-thiadiazolidine-2,5-dithione |
| SMILES | Nc1ccccc1.S=c1[nH][nH]c(=S)s1 |
| InChI | InChI=1S/C6H7N.C2H2N2S3/c7-6-4-2-1-3-5-6;5-1-3-4-2(6)7-1/h1-5H,7H2;(H,3,5)(H,4,6) |
| InChIKey | XUHDPYLSXPSCNC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|