About (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane
(4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane (PubChem CID 67814317) has the molecular formula C14H17F3O
and a molecular weight of 258.28 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane.
Molecular Properties
| Compound Name | (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane |
| PubChem CID | 67814317 |
| Molecular Formula | C14H17F3O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane |
| SMILES | CC1(C)C[C@H](c2ccccc2C(F)(F)F)CCO1 |
| InChI | InChI=1S/C14H17F3O/c1-13(2)9-10(7-8-18-13)11-5-3-4-6-12(11)14(15,16)17/h3-6,10H,7-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | HNUOXZRMBIFSSN-SNVBAGLBSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane?
The IUPAC name of (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane (CID 67814317) is (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane.
What is the SMILES notation for (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane?
The canonical SMILES for (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane is CC1(C)C[C@H](c2ccccc2C(F)(F)F)CCO1.
What is the InChIKey of (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane?
The InChIKey is HNUOXZRMBIFSSN-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H17F3O/c1-13(2)9-10(7-8-18-13)11-5-3-4-6-12(11)14(15,16)17/h3-6,10H,7-9H2,1-2H3/t10-/m1/s1.
What are the key properties of (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane?
(4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane has a molecular weight of 258.28 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-dimethyl-4-[2-(trifluoromethyl)phenyl]oxane is sourced from PubChem (CID 67814317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).