C30H31F3N4O5 — CID 67814357
3-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-4-oxo-3H-chromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 67814357) has the molecular formula C30H31F3N4O5 and a molecular weight of 584.60 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-4-oxo-3H-chromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-4-oxo-3H-chromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 67814357 |
| Molecular Formula | C30H31F3N4O5 |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 3-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-4-oxo-3H-chromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)C(=O)CC(C)(CCOc1ccc(NC(=O)c3cccc(N=C(N)N)c3)cc1C(F)(F)F)O2 |
| InChI | InChI=1S/C30H31F3N4O5/c1-15-16(2)26-24(17(3)25(15)39)22(38)14-29(4,42-26)10-11-41-23-9-8-20(13-21(23)30(31,32)33)36-27(40)18-6-5-7-19(12-18)37-28(34)35/h5-9,12-13,39H,10-11,14H2,1-4H3,(H,36,40)(H4,34,35,37) |
| InChIKey | JSNQQQWAUGZAGI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|