C9H4BrCl3N2O — CID 67814401
1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2,2,2-trichloroethanone (PubChem CID 67814401) has the molecular formula C9H4BrCl3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2,2,2-trichloroethanone.
| Compound Name | 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2,2,2-trichloroethanone |
|---|---|
| PubChem CID | 67814401 |
| Molecular Formula | C9H4BrCl3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 339.86 |
| IUPAC Name | 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2,2,2-trichloroethanone |
| SMILES | O=C(c1c[nH]c2ncc(Br)cc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H4BrCl3N2O/c10-4-1-5-6(7(16)9(11,12)13)3-15-8(5)14-2-4/h1-3H,(H,14,15) |
| InChIKey | MOSBNBIYNUINNV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|