C49H60N6O6 — CID 67814762
3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid;3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2-methyl-1H-indole-5-carboxylic acid (PubChem CID 67814762) has the molecular formula C49H60N6O6 and a molecular weight of 829.06 g/mol. Its IUPAC name is 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid;3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2-methyl-1H-indole-5-carboxylic acid.
| Compound Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid;3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2-methyl-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 67814762 |
| Molecular Formula | C49H60N6O6 |
| Molecular Weight | 829.06 g/mol |
| Exact Mass | 828.46 |
| IUPAC Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid;3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2-methyl-1H-indole-5-carboxylic acid |
| SMILES | COc1ccccc1N1CCN(CCCCc2c(C)[nH]c3ccc(C(=O)O)cc23)CC1.COc1ccccc1N1CCN(CCCCc2c[nH]c3ccc(C(=O)O)cc23)CC1 |
| InChI | InChI=1S/C25H31N3O3.C24H29N3O3/c1-18-20(21-17-19(25(29)30)10-11-22(21)26-18)7-5-6-12-27-13-15-28(16-14-27)23-8-3-4-9-24(23)31-2;1-30-23-8-3-2-7-22(23)27-14-12-26(13-15-27)11-5-4-6-19-17-25-21-10-9-18(24(28)29)16-20(19)21/h3-4,8-11,17,26H,5-7,12-16H2,1-2H3,(H,29,30);2-3,7-10,16-17,25H,4-6,11-15H2,1H3,(H,28,29) |
| InChIKey | AWQCPNQJEYBUND-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 137.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.06 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|