C18H14ClN3O2 — CID 67814797
9-(4-chlorophenyl)-12-methoxy-7-methyl-5-oxa-4,8,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,8,10,12-hexaene (PubChem CID 67814797) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-12-methoxy-7-methyl-5-oxa-4,8,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,8,10,12-hexaene.
| Compound Name | 9-(4-chlorophenyl)-12-methoxy-7-methyl-5-oxa-4,8,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,8,10,12-hexaene |
|---|---|
| PubChem CID | 67814797 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 9-(4-chlorophenyl)-12-methoxy-7-methyl-5-oxa-4,8,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,8,10,12-hexaene |
| SMILES | COc1cc2c(cn1)-c1cnoc1C(C)N=C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClN3O2/c1-10-18-15(9-21-24-18)14-8-20-16(23-2)7-13(14)17(22-10)11-3-5-12(19)6-4-11/h3-10H,1-2H3 |
| InChIKey | BTABGVIAKWXSSU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 60.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |