C13H19NO3 — CID 67814802
prop-2-enyl 1-oxo-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinoline-3-carboxylate (PubChem CID 67814802) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is prop-2-enyl 1-oxo-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinoline-3-carboxylate.
| Compound Name | prop-2-enyl 1-oxo-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 67814802 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | prop-2-enyl 1-oxo-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinoline-3-carboxylate |
| SMILES | C=CCOC(=O)C1CC2CCCCC2C(=O)N1 |
| InChI | InChI=1S/C13H19NO3/c1-2-7-17-13(16)11-8-9-5-3-4-6-10(9)12(15)14-11/h2,9-11H,1,3-8H2,(H,14,15) |
| InChIKey | PYOKOCWCJAKEDR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|