C19H21FN2O2 — CID 67814910
cis-(1S,3R)-N-[(1R)-1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine (PubChem CID 67814910) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is cis-(1S,3R)-N-[(1R)-1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-N-[(1R)-1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 67814910 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | cis-(1S,3R)-N-[(1R)-1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine |
| SMILES | C[C@@H](N[C@H]1CC[C@@H](c2ccc(F)nc2)C1)c1cccc2c1OCO2 |
| InChI | InChI=1S/C19H21FN2O2/c1-12(16-3-2-4-17-19(16)24-11-23-17)22-15-7-5-13(9-15)14-6-8-18(20)21-10-14/h2-4,6,8,10,12-13,15,22H,5,7,9,11H2,1H3/t12-,13-,15+/m1/s1 |
| InChIKey | ZAXZWGSLUSCDND-NFAWXSAZSA-N |
| XLogP | 3.94 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|