C44H60N2O6 — CID 67814932
5-[[[3-[5-(2-tert-butyl-N-(2-tert-butyl-4-hydroxyphenyl)-4-hydroxyanilino)hexyl]-4-(2-methylpropyl)phenyl]methylamino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 67814932) has the molecular formula C44H60N2O6 and a molecular weight of 712.97 g/mol. Its IUPAC name is 5-[[[3-[5-(2-tert-butyl-N-(2-tert-butyl-4-hydroxyphenyl)-4-hydroxyanilino)hexyl]-4-(2-methylpropyl)phenyl]methylamino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[[3-[5-(2-tert-butyl-N-(2-tert-butyl-4-hydroxyphenyl)-4-hydroxyanilino)hexyl]-4-(2-methylpropyl)phenyl]methylamino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 67814932 |
| Molecular Formula | C44H60N2O6 |
| Molecular Weight | 712.97 g/mol |
| Exact Mass | 712.45 |
| IUPAC Name | 5-[[[3-[5-(2-tert-butyl-N-(2-tert-butyl-4-hydroxyphenyl)-4-hydroxyanilino)hexyl]-4-(2-methylpropyl)phenyl]methylamino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC(C)Cc1ccc(CNC=C2C(=O)OC(C)(C)OC2=O)cc1CCCCC(C)N(c1ccc(O)cc1C(C)(C)C)c1ccc(O)cc1C(C)(C)C |
| InChI | InChI=1S/C44H60N2O6/c1-28(2)22-32-17-16-30(26-45-27-35-40(49)51-44(10,11)52-41(35)50)23-31(32)15-13-12-14-29(3)46(38-20-18-33(47)24-36(38)42(4,5)6)39-21-19-34(48)25-37(39)43(7,8)9/h16-21,23-25,27-29,45,47-48H,12-15,22,26H2,1-11H3 |
| InChIKey | HBETYCNXWVIEFG-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.97 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|