C10H4N2O2 — CID 67815094
2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8-pentaene-10,11-dione (PubChem CID 67815094) has the molecular formula C10H4N2O2 and a molecular weight of 184.15 g/mol. Its IUPAC name is 2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8-pentaene-10,11-dione.
| Compound Name | 2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8-pentaene-10,11-dione |
|---|---|
| PubChem CID | 67815094 |
| Molecular Formula | C10H4N2O2 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8-pentaene-10,11-dione |
| SMILES | O=C1C=c2nccc3c2=C(N=C3)C1=O |
| InChI | InChI=1S/C10H4N2O2/c13-7-3-6-8-5(1-2-11-6)4-12-9(8)10(7)14/h1-4H |
| InChIKey | HKWQJQLUGFZZIF-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|