C34H27N5O4 — CID 67816278
benzyl 12-(1H-indole-2-carbonylamino)-13-oxo-10-phenyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraene-4-carboxylate (PubChem CID 67816278) has the molecular formula C34H27N5O4 and a molecular weight of 569.62 g/mol. Its IUPAC name is benzyl 12-(1H-indole-2-carbonylamino)-13-oxo-10-phenyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraene-4-carboxylate.
| Compound Name | benzyl 12-(1H-indole-2-carbonylamino)-13-oxo-10-phenyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 67816278 |
| Molecular Formula | C34H27N5O4 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | benzyl 12-(1H-indole-2-carbonylamino)-13-oxo-10-phenyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraene-4-carboxylate |
| SMILES | O=C(NC1N=C(c2ccccc2)c2cccc3c2N(CCN3C(=O)OCc2ccccc2)C1=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C34H27N5O4/c40-32(27-20-24-14-7-8-16-26(24)35-27)37-31-33(41)39-19-18-38(34(42)43-21-22-10-3-1-4-11-22)28-17-9-15-25(30(28)39)29(36-31)23-12-5-2-6-13-23/h1-17,20,31,35H,18-19,21H2,(H,37,40) |
| InChIKey | JFOHYYUEFWHOOV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |