About 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline
2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline (PubChem CID 67816441) has the molecular formula C13H15FN2S
and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline |
| PubChem CID | 67816441 |
| Molecular Formula | C13H15FN2S |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline |
| SMILES | CCCN(Cc1nccs1)c1ccccc1F |
| InChI | InChI=1S/C13H15FN2S/c1-2-8-16(10-13-15-7-9-17-13)12-6-4-3-5-11(12)14/h3-7,9H,2,8,10H2,1H3 |
| InChIKey | JVDFIIVFCFMHJZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline?
The IUPAC name of 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline (CID 67816441) is 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline.
What is the SMILES notation for 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline?
The canonical SMILES for 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline is CCCN(Cc1nccs1)c1ccccc1F.
What is the InChIKey of 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline?
The InChIKey is JVDFIIVFCFMHJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2S/c1-2-8-16(10-13-15-7-9-17-13)12-6-4-3-5-11(12)14/h3-7,9H,2,8,10H2,1H3.
What are the key properties of 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline?
2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline has a molecular weight of 250.34 g/mol, XLogP of 3.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-propyl-N-(1,3-thiazol-2-ylmethyl)aniline is sourced from PubChem (CID 67816441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).