C9H13NO — CID 67816658
(4aR,8aR)-3,4,4a,5,6,8a-hexahydro-2H-isoquinolin-1-one (PubChem CID 67816658) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (4aR,8aR)-3,4,4a,5,6,8a-hexahydro-2H-isoquinolin-1-one.
| Compound Name | (4aR,8aR)-3,4,4a,5,6,8a-hexahydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 67816658 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (4aR,8aR)-3,4,4a,5,6,8a-hexahydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCC[C@H]2CCC=C[C@H]12 |
| InChI | InChI=1S/C9H13NO/c11-9-8-4-2-1-3-7(8)5-6-10-9/h2,4,7-8H,1,3,5-6H2,(H,10,11)/t7-,8+/m1/s1 |
| InChIKey | PEJUBXNIEZFASY-SFYZADRCSA-N |
| XLogP | 1.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|