About 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine
5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine (PubChem CID 67816670) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 67816670 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CC1C(N)=CC=CC1(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H27N/c1-11-12(16)9-8-10-15(11,13(2,3)4)14(5,6)7/h8-11H,16H2,1-7H3 |
| InChIKey | DXLFFFPFILLKEW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine (CID 67816670) is 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine is CC1C(N)=CC=CC1(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine?
The InChIKey is DXLFFFPFILLKEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-11-12(16)9-8-10-15(11,13(2,3)4)14(5,6)7/h8-11H,16H2,1-7H3.
What are the key properties of 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine?
5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine has a molecular weight of 221.39 g/mol, XLogP of 4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-ditert-butyl-6-methylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 67816670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).