C49H54N8O4 — CID 67816731
3-[4-[4-(3-cyanophenyl)piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid;3-[4-[4-(3-cyanophenyl)piperazin-1-yl]butyl]-2-methyl-1H-indole-5-carboxylic acid (PubChem CID 67816731) has the molecular formula C49H54N8O4 and a molecular weight of 819.02 g/mol. Its IUPAC name is 3-[4-[4-(3-cyanophenyl)piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid;3-[4-[4-(3-cyanophenyl)piperazin-1-yl]butyl]-2-methyl-1H-indole-5-carboxylic acid.
| Compound Name | 3-[4-[4-(3-cyanophenyl)piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid;3-[4-[4-(3-cyanophenyl)piperazin-1-yl]butyl]-2-methyl-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 67816731 |
| Molecular Formula | C49H54N8O4 |
| Molecular Weight | 819.02 g/mol |
| Exact Mass | 818.43 |
| IUPAC Name | 3-[4-[4-(3-cyanophenyl)piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid;3-[4-[4-(3-cyanophenyl)piperazin-1-yl]butyl]-2-methyl-1H-indole-5-carboxylic acid |
| SMILES | Cc1[nH]c2ccc(C(=O)O)cc2c1CCCCN1CCN(c2cccc(C#N)c2)CC1.N#Cc1cccc(N2CCN(CCCCc3c[nH]c4ccc(C(=O)O)cc34)CC2)c1 |
| InChI | InChI=1S/C25H28N4O2.C24H26N4O2/c1-18-22(23-16-20(25(30)31)8-9-24(23)27-18)7-2-3-10-28-11-13-29(14-12-28)21-6-4-5-19(15-21)17-26;25-16-18-4-3-6-21(14-18)28-12-10-27(11-13-28)9-2-1-5-20-17-26-23-8-7-19(24(29)30)15-22(20)23/h4-6,8-9,15-16,27H,2-3,7,10-14H2,1H3,(H,30,31);3-4,6-8,14-15,17,26H,1-2,5,9-13H2,(H,29,30) |
| InChIKey | SNLZSMMIOHDPOC-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 166.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.02 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|