About 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione
8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione (PubChem CID 67817999) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione |
| PubChem CID | 67817999 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione |
| SMILES | CCCCC1=NC2(C)C(=N1)C(=O)N(CCC)C(=O)N2CCC |
| InChI | InChI=1S/C16H26N4O2/c1-5-8-9-12-17-13-14(21)19(10-6-2)15(22)20(11-7-3)16(13,4)18-12/h5-11H2,1-4H3 |
| InChIKey | ISHQGNASUAQGBZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione?
The IUPAC name of 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione (CID 67817999) is 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione.
What is the SMILES notation for 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione?
The canonical SMILES for 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione is CCCCC1=NC2(C)C(=N1)C(=O)N(CCC)C(=O)N2CCC.
What is the InChIKey of 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione?
The InChIKey is ISHQGNASUAQGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-5-8-9-12-17-13-14(21)19(10-6-2)15(22)20(11-7-3)16(13,4)18-12/h5-11H2,1-4H3.
What are the key properties of 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione?
8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione has a molecular weight of 306.41 g/mol, XLogP of 2.83, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-butyl-4-methyl-1,3-dipropylpurine-2,6-dione is sourced from PubChem (CID 67817999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).