C24H32ClN3O4 — CID 67818092
2-[4-(diaminomethylideneamino)phenyl]-4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butanoic acid;hydrochloride (PubChem CID 67818092) has the molecular formula C24H32ClN3O4 and a molecular weight of 461.99 g/mol. Its IUPAC name is 2-[4-(diaminomethylideneamino)phenyl]-4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butanoic acid;hydrochloride.
| Compound Name | 2-[4-(diaminomethylideneamino)phenyl]-4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67818092 |
| Molecular Formula | C24H32ClN3O4 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-[4-(diaminomethylideneamino)phenyl]-4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butanoic acid;hydrochloride |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCC(C(=O)O)c1ccc(N=C(N)N)cc1)O2.Cl |
| InChI | InChI=1S/C24H31N3O4.ClH/c1-13-14(2)21-18(15(3)20(13)28)9-11-24(4,31-21)12-10-19(22(29)30)16-5-7-17(8-6-16)27-23(25)26;/h5-8,19,28H,9-12H2,1-4H3,(H,29,30)(H4,25,26,27);1H |
| InChIKey | LMDURKTYGJRMTH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|