About 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine
1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine (PubChem CID 67818284) has the molecular formula C12H20FN3
and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine |
| PubChem CID | 67818284 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine |
| SMILES | Cc1nc(CN(C)C)nc(C)c1CCCF |
| InChI | InChI=1S/C12H20FN3/c1-9-11(6-5-7-13)10(2)15-12(14-9)8-16(3)4/h5-8H2,1-4H3 |
| InChIKey | CRARRQVOMAGZSW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine (CID 67818284) is 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine is Cc1nc(CN(C)C)nc(C)c1CCCF.
What is the InChIKey of 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine?
The InChIKey is CRARRQVOMAGZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20FN3/c1-9-11(6-5-7-13)10(2)15-12(14-9)8-16(3)4/h5-8H2,1-4H3.
What are the key properties of 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine?
1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine has a molecular weight of 225.31 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3-fluoropropyl)-4,6-dimethylpyrimidin-2-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 67818284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).