C11H11BrO2 — CID 67818499
5-bromospiro[1,3-dihydroindene-2,2'-1,3-dioxolane] (PubChem CID 67818499) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is 5-bromospiro[1,3-dihydroindene-2,2'-1,3-dioxolane].
| Compound Name | 5-bromospiro[1,3-dihydroindene-2,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 67818499 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 5-bromospiro[1,3-dihydroindene-2,2'-1,3-dioxolane] |
| SMILES | Brc1ccc2c(c1)CC1(C2)OCCO1 |
| InChI | InChI=1S/C11H11BrO2/c12-10-2-1-8-6-11(7-9(8)5-10)13-3-4-14-11/h1-2,5H,3-4,6-7H2 |
| InChIKey | GEPTWXIPFQNFNY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |