C20H21N3O — CID 67819773
3-[(5-methyl-1H-imidazol-4-yl)methyl]-10-prop-2-enyl-2,3-dihydro-1H-pyrido[1,2-a]indol-4-one (PubChem CID 67819773) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-[(5-methyl-1H-imidazol-4-yl)methyl]-10-prop-2-enyl-2,3-dihydro-1H-pyrido[1,2-a]indol-4-one.
| Compound Name | 3-[(5-methyl-1H-imidazol-4-yl)methyl]-10-prop-2-enyl-2,3-dihydro-1H-pyrido[1,2-a]indol-4-one |
|---|---|
| PubChem CID | 67819773 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 3-[(5-methyl-1H-imidazol-4-yl)methyl]-10-prop-2-enyl-2,3-dihydro-1H-pyrido[1,2-a]indol-4-one |
| SMILES | C=CCc1c2c(n3ccccc13)C(=O)C(Cc1nc[nH]c1C)CC2 |
| InChI | InChI=1S/C20H21N3O/c1-3-6-15-16-9-8-14(11-17-13(2)21-12-22-17)20(24)19(16)23-10-5-4-7-18(15)23/h3-5,7,10,12,14H,1,6,8-9,11H2,2H3,(H,21,22) |
| InChIKey | BSCTZDPUBLQSQF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|