C11H13N9OS — CID 67819798
2-[4-[5-[amino-(3-amino-1H-1,2,4-triazol-5-yl)methyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine (PubChem CID 67819798) has the molecular formula C11H13N9OS and a molecular weight of 319.35 g/mol. Its IUPAC name is 2-[4-[5-[amino-(3-amino-1H-1,2,4-triazol-5-yl)methyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[5-[amino-(3-amino-1H-1,2,4-triazol-5-yl)methyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 67819798 |
| Molecular Formula | C11H13N9OS |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[4-[5-[amino-(3-amino-1H-1,2,4-triazol-5-yl)methyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(-c2ccc(C(N)c3nc(N)n[nH]3)o2)cs1 |
| InChI | InChI=1S/C11H13N9OS/c12-7(8-17-10(15)20-19-8)6-2-1-5(21-6)4-3-22-11(16-4)18-9(13)14/h1-3,7H,12H2,(H4,13,14,16,18)(H3,15,17,19,20) |
| InChIKey | IHELGCMZYDOCMZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|