C34H58O3Si4 — CID 67819916
2,2,3,6-tetraethyl-6-phenyl-3-(2,2,3,6-tetraethyl-6-phenyloxadisilinan-3-yl)oxyoxadisilinane (PubChem CID 67819916) has the molecular formula C34H58O3Si4 and a molecular weight of 627.18 g/mol. Its IUPAC name is 2,2,3,6-tetraethyl-6-phenyl-3-(2,2,3,6-tetraethyl-6-phenyloxadisilinan-3-yl)oxyoxadisilinane.
| Compound Name | 2,2,3,6-tetraethyl-6-phenyl-3-(2,2,3,6-tetraethyl-6-phenyloxadisilinan-3-yl)oxyoxadisilinane |
|---|---|
| PubChem CID | 67819916 |
| Molecular Formula | C34H58O3Si4 |
| Molecular Weight | 627.18 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | 2,2,3,6-tetraethyl-6-phenyl-3-(2,2,3,6-tetraethyl-6-phenyloxadisilinan-3-yl)oxyoxadisilinane |
| SMILES | CCC1(c2ccccc2)CC[Si](CC)(O[Si]2(CC)CCC(CC)(c3ccccc3)O[Si]2(CC)CC)[Si](CC)(CC)O1 |
| InChI | InChI=1S/C34H58O3Si4/c1-9-33(31-23-19-17-20-24-31)27-29-40(15-7,38(11-3,12-4)35-33)37-41(16-8)30-28-34(10-2,32-25-21-18-22-26-32)36-39(41,13-5)14-6/h17-26H,9-16,27-30H2,1-8H3 |
| InChIKey | HABQLAMNYAHFRE-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.18 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|