About N,N-diethylethanamine;1H-pyridin-2-one
N,N-diethylethanamine;1H-pyridin-2-one (PubChem CID 67819994) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is N,N-diethylethanamine;1H-pyridin-2-one.
Molecular Properties
| Compound Name | N,N-diethylethanamine;1H-pyridin-2-one |
| PubChem CID | 67819994 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N,N-diethylethanamine;1H-pyridin-2-one |
| SMILES | CCN(CC)CC.O=c1cccc[nH]1 |
| InChI | InChI=1S/C6H15N.C5H5NO/c1-4-7(5-2)6-3;7-5-3-1-2-4-6-5/h4-6H2,1-3H3;1-4H,(H,6,7) |
| InChIKey | FLSFXZBPPCIMLC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;1H-pyridin-2-one?
The IUPAC name of N,N-diethylethanamine;1H-pyridin-2-one (CID 67819994) is N,N-diethylethanamine;1H-pyridin-2-one.
What is the SMILES notation for N,N-diethylethanamine;1H-pyridin-2-one?
The canonical SMILES for N,N-diethylethanamine;1H-pyridin-2-one is CCN(CC)CC.O=c1cccc[nH]1.
What is the InChIKey of N,N-diethylethanamine;1H-pyridin-2-one?
The InChIKey is FLSFXZBPPCIMLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C5H5NO/c1-4-7(5-2)6-3;7-5-3-1-2-4-6-5/h4-6H2,1-3H3;1-4H,(H,6,7).
What are the key properties of N,N-diethylethanamine;1H-pyridin-2-one?
N,N-diethylethanamine;1H-pyridin-2-one has a molecular weight of 196.29 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;1H-pyridin-2-one is sourced from PubChem (CID 67819994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).