C44H30N6 — CID 67820310
3,5,7,8-tetraphenylporphyrin-2,20-diamine (PubChem CID 67820310) has the molecular formula C44H30N6 and a molecular weight of 642.77 g/mol. Its IUPAC name is 3,5,7,8-tetraphenylporphyrin-2,20-diamine.
| Compound Name | 3,5,7,8-tetraphenylporphyrin-2,20-diamine |
|---|---|
| PubChem CID | 67820310 |
| Molecular Formula | C44H30N6 |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 3,5,7,8-tetraphenylporphyrin-2,20-diamine |
| SMILES | NC1=C(c2ccccc2)/C2=C(\c3ccccc3)C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/N)C1=N2)C=C5)C=C4)C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C44H30N6/c45-40-34-24-23-32(48-34)25-31-21-22-33(47-31)26-35-36(27-13-5-1-6-14-27)37(28-15-7-2-8-16-28)42(49-35)39(30-19-11-4-12-20-30)43-38(41(46)44(40)50-43)29-17-9-3-10-18-29/h1-26H,45-46H2/b31-25-,32-25-,33-26-,35-26-,40-34+,42-39-,43-39-,44-40+ |
| InChIKey | YEQVEUWGXYFURW-NAVDPBBRSA-N |
| XLogP | 8.26 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|