C29H40N2O7 — CID 67820502
tert-butyl N-[(2R,3R,5R,9S)-10-amino-5-benzyl-3,5,9-trihydroxy-8-methyl-6,10-dioxo-1-phenyldecan-2-yl]carbamate (PubChem CID 67820502) has the molecular formula C29H40N2O7 and a molecular weight of 528.65 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,5R,9S)-10-amino-5-benzyl-3,5,9-trihydroxy-8-methyl-6,10-dioxo-1-phenyldecan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,5R,9S)-10-amino-5-benzyl-3,5,9-trihydroxy-8-methyl-6,10-dioxo-1-phenyldecan-2-yl]carbamate |
|---|---|
| PubChem CID | 67820502 |
| Molecular Formula | C29H40N2O7 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | tert-butyl N-[(2R,3R,5R,9S)-10-amino-5-benzyl-3,5,9-trihydroxy-8-methyl-6,10-dioxo-1-phenyldecan-2-yl]carbamate |
| SMILES | CC(CC(=O)[C@@](O)(Cc1ccccc1)C[C@@H](O)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C)[C@H](O)C(N)=O |
| InChI | InChI=1S/C29H40N2O7/c1-19(25(34)26(30)35)15-24(33)29(37,17-21-13-9-6-10-14-21)18-23(32)22(16-20-11-7-5-8-12-20)31-27(36)38-28(2,3)4/h5-14,19,22-23,25,32,34,37H,15-18H2,1-4H3,(H2,30,35)(H,31,36)/t19?,22-,23-,25+,29-/m1/s1 |
| InChIKey | XNFHZXFLEJNNQV-JAKJLUMISA-N |
| XLogP | 2.29 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |