About CID 67820552
CID 67820552 (PubChem CID 67820552) has the molecular formula C20H18Si
and a molecular weight of 286.45 g/mol.
Molecular Properties
| Compound Name | CID 67820552 |
| PubChem CID | 67820552 |
| Molecular Formula | C20H18Si |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | — |
| SMILES | C1=Cc2ccccc21.C1=Cc2ccccc21.C=C[Si]C=C |
| InChI | InChI=1S/2C8H6.C4H6Si/c2*1-2-4-8-6-5-7(8)3-1;1-3-5-4-2/h2*1-6H;3-4H,1-2H2 |
| InChIKey | YEGIKKZLZQKWNP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67820552 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67820552?
The IUPAC name of CID 67820552 (CID 67820552) is not available.
What is the SMILES notation for CID 67820552?
The canonical SMILES for CID 67820552 is C1=Cc2ccccc21.C1=Cc2ccccc21.C=C[Si]C=C.
What is the InChIKey of CID 67820552?
The InChIKey is YEGIKKZLZQKWNP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H6.C4H6Si/c2*1-2-4-8-6-5-7(8)3-1;1-3-5-4-2/h2*1-6H;3-4H,1-2H2.
What are the key properties of CID 67820552?
CID 67820552 has a molecular weight of 286.45 g/mol, XLogP of 5.32, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67820552 is sourced from PubChem (CID 67820552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).