C19H30O3 — CID 67820690
(3aS,4S,5R,6aS)-5-hydroxy-4-[(E)-4-hydroxy-5,5-dimethyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one (PubChem CID 67820690) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-5-hydroxy-4-[(E)-4-hydroxy-5,5-dimethyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one.
| Compound Name | (3aS,4S,5R,6aS)-5-hydroxy-4-[(E)-4-hydroxy-5,5-dimethyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 67820690 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3aS,4S,5R,6aS)-5-hydroxy-4-[(E)-4-hydroxy-5,5-dimethyloct-1-enyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
| SMILES | C=C1C[C@H]2[C@H](/C=C/CC(O)C(C)(C)CCC)[C@H](O)C[C@@H]2C1=O |
| InChI | InChI=1S/C19H30O3/c1-5-9-19(3,4)17(21)8-6-7-13-14-10-12(2)18(22)15(14)11-16(13)20/h6-7,13-17,20-21H,2,5,8-11H2,1,3-4H3/b7-6+/t13-,14-,15-,16+,17?/m0/s1 |
| InChIKey | QFOUVRPSBDTDDP-DKDMRNAASA-N |
| XLogP | 3.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|