C18H24N4+2 — CID 67820954
1,4-diazabicyclo[2.2.2]octane;7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene (PubChem CID 67820954) has the molecular formula C18H24N4+2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene.
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 67820954 |
| Molecular Formula | C18H24N4+2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene |
| SMILES | C1CN2CCN1CC2.c1cc[n+]2c(c1)-c1cccc[n+]1CC2 |
| InChI | InChI=1S/C12H12N2.C6H12N2/c1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1;1-2-8-5-3-7(1)4-6-8/h1-8H,9-10H2;1-6H2/q+2; |
| InChIKey | TXYCEFZLVAETKL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|