C12H14O8S — CID 67821005
4-(3,4,4-trihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-3,5-diene-1,1,2-triol (PubChem CID 67821005) has the molecular formula C12H14O8S and a molecular weight of 318.30 g/mol. Its IUPAC name is 4-(3,4,4-trihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-3,5-diene-1,1,2-triol.
| Compound Name | 4-(3,4,4-trihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-3,5-diene-1,1,2-triol |
|---|---|
| PubChem CID | 67821005 |
| Molecular Formula | C12H14O8S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 4-(3,4,4-trihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-3,5-diene-1,1,2-triol |
| SMILES | O=S(=O)(C1=CC(O)C(O)(O)C=C1)C1=CC(O)C(O)(O)C=C1 |
| InChI | InChI=1S/C12H14O8S/c13-9-5-7(1-3-11(9,15)16)21(19,20)8-2-4-12(17,18)10(14)6-8/h1-6,9-10,13-18H |
| InChIKey | MHRMQZVIKZURGN-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|