About 1-pentyl-2H-pyridine-2,6-diamine
1-pentyl-2H-pyridine-2,6-diamine (PubChem CID 67821358) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-pentyl-2H-pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 1-pentyl-2H-pyridine-2,6-diamine |
| PubChem CID | 67821358 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-pentyl-2H-pyridine-2,6-diamine |
| SMILES | CCCCCN1C(N)=CC=CC1N |
| InChI | InChI=1S/C10H19N3/c1-2-3-4-8-13-9(11)6-5-7-10(13)12/h5-7,9H,2-4,8,11-12H2,1H3 |
| InChIKey | BMDQNMCVYYSMQA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentyl-2H-pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentyl-2H-pyridine-2,6-diamine?
The IUPAC name of 1-pentyl-2H-pyridine-2,6-diamine (CID 67821358) is 1-pentyl-2H-pyridine-2,6-diamine.
What is the SMILES notation for 1-pentyl-2H-pyridine-2,6-diamine?
The canonical SMILES for 1-pentyl-2H-pyridine-2,6-diamine is CCCCCN1C(N)=CC=CC1N.
What is the InChIKey of 1-pentyl-2H-pyridine-2,6-diamine?
The InChIKey is BMDQNMCVYYSMQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-2-3-4-8-13-9(11)6-5-7-10(13)12/h5-7,9H,2-4,8,11-12H2,1H3.
What are the key properties of 1-pentyl-2H-pyridine-2,6-diamine?
1-pentyl-2H-pyridine-2,6-diamine has a molecular weight of 181.28 g/mol, XLogP of 1.13, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentyl-2H-pyridine-2,6-diamine is sourced from PubChem (CID 67821358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).