C8H12N4O2 — CID 67821983
5,6-diamino-2-methoxy-3-prop-2-enylpyrimidin-4-one (PubChem CID 67821983) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 5,6-diamino-2-methoxy-3-prop-2-enylpyrimidin-4-one.
| Compound Name | 5,6-diamino-2-methoxy-3-prop-2-enylpyrimidin-4-one |
|---|---|
| PubChem CID | 67821983 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 5,6-diamino-2-methoxy-3-prop-2-enylpyrimidin-4-one |
| SMILES | C=CCn1c(OC)nc(N)c(N)c1=O |
| InChI | InChI=1S/C8H12N4O2/c1-3-4-12-7(13)5(9)6(10)11-8(12)14-2/h3H,1,4,9-10H2,2H3 |
| InChIKey | AQKBKEZBKRHCEE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|