C30H30O4S — CID 67822105
[2,3,4-tris(1-phenylethyl)phenyl] hydrogen sulfate (PubChem CID 67822105) has the molecular formula C30H30O4S and a molecular weight of 486.63 g/mol. Its IUPAC name is [2,3,4-tris(1-phenylethyl)phenyl] hydrogen sulfate.
| Compound Name | [2,3,4-tris(1-phenylethyl)phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 67822105 |
| Molecular Formula | C30H30O4S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [2,3,4-tris(1-phenylethyl)phenyl] hydrogen sulfate |
| SMILES | CC(c1ccccc1)c1ccc(OS(=O)(=O)O)c(C(C)c2ccccc2)c1C(C)c1ccccc1 |
| InChI | InChI=1S/C30H30O4S/c1-21(24-13-7-4-8-14-24)27-19-20-28(34-35(31,32)33)30(23(3)26-17-11-6-12-18-26)29(27)22(2)25-15-9-5-10-16-25/h4-23H,1-3H3,(H,31,32,33) |
| InChIKey | TVRZFZKROXHWOR-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|