C19H29N3O5 — CID 67822109
4-butyl-1-phenylpyrazolidine-3,5-dione;ethane-1,2-diol;pyrrolidin-2-one (PubChem CID 67822109) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-butyl-1-phenylpyrazolidine-3,5-dione;ethane-1,2-diol;pyrrolidin-2-one.
| Compound Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;ethane-1,2-diol;pyrrolidin-2-one |
|---|---|
| PubChem CID | 67822109 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;ethane-1,2-diol;pyrrolidin-2-one |
| SMILES | CCCCC1C(=O)NN(c2ccccc2)C1=O.O=C1CCCN1.OCCO |
| InChI | InChI=1S/C13H16N2O2.C4H7NO.C2H6O2/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;6-4-2-1-3-5-4;3-1-2-4/h4-8,11H,2-3,9H2,1H3,(H,14,16);1-3H2,(H,5,6);3-4H,1-2H2 |
| InChIKey | NWRVLDPAEKEJIB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|