C39H61O8P — CID 67822140
1,3,7,9-tetratert-butyl-11-[(2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-5H-benzo[d][1,3,2]benzodioxaphosphocine (PubChem CID 67822140) has the molecular formula C39H61O8P and a molecular weight of 688.88 g/mol. Its IUPAC name is 1,3,7,9-tetratert-butyl-11-[(2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-5H-benzo[d][1,3,2]benzodioxaphosphocine.
| Compound Name | 1,3,7,9-tetratert-butyl-11-[(2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-5H-benzo[d][1,3,2]benzodioxaphosphocine |
|---|---|
| PubChem CID | 67822140 |
| Molecular Formula | C39H61O8P |
| Molecular Weight | 688.88 g/mol |
| Exact Mass | 688.41 |
| IUPAC Name | 1,3,7,9-tetratert-butyl-11-[(2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-5H-benzo[d][1,3,2]benzodioxaphosphocine |
| SMILES | COC[C@H]1O[C@@H](OP2Oc3c(cc(C(C)(C)C)cc3C(C)(C)C)Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3O2)[C@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C39H61O8P/c1-36(2,3)25-18-23-17-24-19-26(37(4,5)6)21-28(39(10,11)12)31(24)46-48(45-30(23)27(20-25)38(7,8)9)47-35-34(43-16)33(42-15)32(41-14)29(44-35)22-40-13/h18-21,29,32-35H,17,22H2,1-16H3/t29-,32-,33+,34-,35+/m1/s1 |
| InChIKey | QFRJOLAGNRBZRV-KLBZSSGQSA-N |
| XLogP | 8.90 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.88 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|