C24H34N2O4 — CID 67822253
2-[4-[(8-methoxy-3,4-dihydro-1H-isochromen-4-yl)-propylamino]butyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 67822253) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[4-[(8-methoxy-3,4-dihydro-1H-isochromen-4-yl)-propylamino]butyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 2-[4-[(8-methoxy-3,4-dihydro-1H-isochromen-4-yl)-propylamino]butyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 67822253 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-[4-[(8-methoxy-3,4-dihydro-1H-isochromen-4-yl)-propylamino]butyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | CCCN(CCCCN1C(=O)C2CCCC2C1=O)C1COCc2c(OC)cccc21 |
| InChI | InChI=1S/C24H34N2O4/c1-3-12-25(21-16-30-15-20-17(21)8-7-11-22(20)29-2)13-4-5-14-26-23(27)18-9-6-10-19(18)24(26)28/h7-8,11,18-19,21H,3-6,9-10,12-16H2,1-2H3 |
| InChIKey | JWFANZYBFPQQJI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|