C34H44N2O10 — CID 67822382
bis[(2R)-2-amino-7-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl] oxalate (PubChem CID 67822382) has the molecular formula C34H44N2O10 and a molecular weight of 640.73 g/mol. Its IUPAC name is bis[(2R)-2-amino-7-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl] oxalate.
| Compound Name | bis[(2R)-2-amino-7-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl] oxalate |
|---|---|
| PubChem CID | 67822382 |
| Molecular Formula | C34H44N2O10 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | bis[(2R)-2-amino-7-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl] oxalate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc2c(c1)C(OC(=O)C(=O)OC1c3cc(OC(C)(C)C(=O)OCC)ccc3CC[C@H]1N)[C@H](N)CC2 |
| InChI | InChI=1S/C34H44N2O10/c1-7-41-31(39)33(3,4)45-21-13-9-19-11-15-25(35)27(23(19)17-21)43-29(37)30(38)44-28-24-18-22(14-10-20(24)12-16-26(28)36)46-34(5,6)32(40)42-8-2/h9-10,13-14,17-18,25-28H,7-8,11-12,15-16,35-36H2,1-6H3/t25-,26-,27?,28?/m1/s1 |
| InChIKey | KTKZUIBWJOEFDO-XPALAHHGSA-N |
| XLogP | 3.54 |
| TPSA | 175.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|