About CID 67822914
CID 67822914 (PubChem CID 67822914) has the molecular formula C12H12AlS
and a molecular weight of 215.28 g/mol.
Molecular Properties
| Compound Name | CID 67822914 |
| PubChem CID | 67822914 |
| Molecular Formula | C12H12AlS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2cccs2)c1C.[Al] |
| InChI | InChI=1S/C12H12S.Al/c1-9-5-3-6-11(10(9)2)12-7-4-8-13-12;/h3-8H,1-2H3; |
| InChIKey | ARIBLJFXGRDRGL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 67822914 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67822914?
The IUPAC name of CID 67822914 (CID 67822914) is not available.
What is the SMILES notation for CID 67822914?
The canonical SMILES for CID 67822914 is Cc1cccc(-c2cccs2)c1C.[Al].
What is the InChIKey of CID 67822914?
The InChIKey is ARIBLJFXGRDRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12S.Al/c1-9-5-3-6-11(10(9)2)12-7-4-8-13-12;/h3-8H,1-2H3;.
What are the key properties of CID 67822914?
CID 67822914 has a molecular weight of 215.28 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67822914 is sourced from PubChem (CID 67822914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).