C20H34O8 — CID 67823219
ethyl 2-[4-(1-ethoxyethoxymethyl)-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-ylidene]acetate (PubChem CID 67823219) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is ethyl 2-[4-(1-ethoxyethoxymethyl)-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-ylidene]acetate.
| Compound Name | ethyl 2-[4-(1-ethoxyethoxymethyl)-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-ylidene]acetate |
|---|---|
| PubChem CID | 67823219 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | ethyl 2-[4-(1-ethoxyethoxymethyl)-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-ylidene]acetate |
| SMILES | CCOC(=O)C=C1CC(OCOC)C2OC(C)(C)OC2C1COC(C)OCC |
| InChI | InChI=1S/C20H34O8/c1-7-23-13(3)25-11-15-14(10-17(21)24-8-2)9-16(26-12-22-6)19-18(15)27-20(4,5)28-19/h10,13,15-16,18-19H,7-9,11-12H2,1-6H3 |
| InChIKey | RBUGPPOFCQYFHI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|