C42H42N8O4 — CID 67823513
N,N'-bis[2-[(5-methoxy-7-methylpyrido[4,3-c]carbazol-1-yl)amino]ethyl]butanediamide (PubChem CID 67823513) has the molecular formula C42H42N8O4 and a molecular weight of 722.85 g/mol. Its IUPAC name is N,N'-bis[2-[(5-methoxy-7-methylpyrido[4,3-c]carbazol-1-yl)amino]ethyl]butanediamide.
| Compound Name | N,N'-bis[2-[(5-methoxy-7-methylpyrido[4,3-c]carbazol-1-yl)amino]ethyl]butanediamide |
|---|---|
| PubChem CID | 67823513 |
| Molecular Formula | C42H42N8O4 |
| Molecular Weight | 722.85 g/mol |
| Exact Mass | 722.33 |
| IUPAC Name | N,N'-bis[2-[(5-methoxy-7-methylpyrido[4,3-c]carbazol-1-yl)amino]ethyl]butanediamide |
| SMILES | COc1cc2c(c3ccccc3n2C)c2c(NCCNC(=O)CCC(=O)NCCNc3nccc4c(OC)cc5c(c6ccccc6n5C)c34)nccc12 |
| InChI | InChI=1S/C42H42N8O4/c1-49-29-11-7-5-9-25(29)37-31(49)23-33(53-3)27-15-17-45-41(39(27)37)47-21-19-43-35(51)13-14-36(52)44-20-22-48-42-40-28(16-18-46-42)34(54-4)24-32-38(40)26-10-6-8-12-30(26)50(32)2/h5-12,15-18,23-24H,13-14,19-22H2,1-4H3,(H,43,51)(H,44,52)(H,45,47)(H,46,48) |
| InChIKey | SVFRESXYSJCIQT-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.85 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|