C40H49N3O5 — CID 67823798
(6R)-4-(3-cyanophenyl)-3-[3-[3-(4,4-diphenylpiperidin-1-yl)propoxy]propyl]-2,5,6-trimethylpiperidine-3,5-dicarboxylic acid (PubChem CID 67823798) has the molecular formula C40H49N3O5 and a molecular weight of 651.85 g/mol. Its IUPAC name is (6R)-4-(3-cyanophenyl)-3-[3-[3-(4,4-diphenylpiperidin-1-yl)propoxy]propyl]-2,5,6-trimethylpiperidine-3,5-dicarboxylic acid.
| Compound Name | (6R)-4-(3-cyanophenyl)-3-[3-[3-(4,4-diphenylpiperidin-1-yl)propoxy]propyl]-2,5,6-trimethylpiperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67823798 |
| Molecular Formula | C40H49N3O5 |
| Molecular Weight | 651.85 g/mol |
| Exact Mass | 651.37 |
| IUPAC Name | (6R)-4-(3-cyanophenyl)-3-[3-[3-(4,4-diphenylpiperidin-1-yl)propoxy]propyl]-2,5,6-trimethylpiperidine-3,5-dicarboxylic acid |
| SMILES | CC1N[C@H](C)C(C)(C(=O)O)C(c2cccc(C#N)c2)C1(CCCOCCCN1CCC(c2ccccc2)(c2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C40H49N3O5/c1-29-38(3,36(44)45)35(32-14-10-13-31(27-32)28-41)40(37(46)47,30(2)42-29)19-11-25-48-26-12-22-43-23-20-39(21-24-43,33-15-6-4-7-16-33)34-17-8-5-9-18-34/h4-10,13-18,27,29-30,35,42H,11-12,19-26H2,1-3H3,(H,44,45)(H,46,47)/t29-,30?,35?,38?,40?/m1/s1 |
| InChIKey | FHAGSEYWDJSWFD-IAFWXQLTSA-N |
| XLogP | 6.45 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.85 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|