About 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile
2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile (PubChem CID 67824195) has the molecular formula C20H16F3N3S2
and a molecular weight of 419.50 g/mol. Its IUPAC name is 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile |
| PubChem CID | 67824195 |
| Molecular Formula | C20H16F3N3S2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)cc1Sc1ccccc1N.Nc1ccccc1S |
| InChI | InChI=1S/C14H9F3N2S.C6H7NS/c15-14(16,17)10-6-5-9(8-18)13(7-10)20-12-4-2-1-3-11(12)19;7-5-3-1-2-4-6(5)8/h1-7H,19H2;1-4,8H,7H2 |
| InChIKey | DKVPLCOTXXUUMQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile?
The IUPAC name of 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile (CID 67824195) is 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile?
The canonical SMILES for 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile is N#Cc1ccc(C(F)(F)F)cc1Sc1ccccc1N.Nc1ccccc1S.
What is the InChIKey of 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile?
The InChIKey is DKVPLCOTXXUUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3N2S.C6H7NS/c15-14(16,17)10-6-5-9(8-18)13(7-10)20-12-4-2-1-3-11(12)19;7-5-3-1-2-4-6(5)8/h1-7H,19H2;1-4,8H,7H2.
What are the key properties of 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile?
2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile has a molecular weight of 419.50 g/mol, XLogP of 5.87, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzenethiol;2-(2-aminophenyl)sulfanyl-4-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 67824195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).