About 1,4-diazabicyclo[2.2.2]octane;piperazine
1,4-diazabicyclo[2.2.2]octane;piperazine (PubChem CID 67824400) has the molecular formula C14H32N6
and a molecular weight of 284.45 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;piperazine.
Molecular Properties
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;piperazine |
| PubChem CID | 67824400 |
| Molecular Formula | C14H32N6 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;piperazine |
| SMILES | C1CN2CCN1CC2.C1CNCCN1.C1CNCCN1 |
| InChI | InChI=1S/C6H12N2.2C4H10N2/c1-2-8-5-3-7(1)4-6-8;2*1-2-6-4-3-5-1/h1-6H2;2*5-6H,1-4H2 |
| InChIKey | BTPPAGHCAXWVPE-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,4-diazabicyclo[2.2.2]octane;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazabicyclo[2.2.2]octane;piperazine?
The IUPAC name of 1,4-diazabicyclo[2.2.2]octane;piperazine (CID 67824400) is 1,4-diazabicyclo[2.2.2]octane;piperazine.
What is the SMILES notation for 1,4-diazabicyclo[2.2.2]octane;piperazine?
The canonical SMILES for 1,4-diazabicyclo[2.2.2]octane;piperazine is C1CN2CCN1CC2.C1CNCCN1.C1CNCCN1.
What is the InChIKey of 1,4-diazabicyclo[2.2.2]octane;piperazine?
The InChIKey is BTPPAGHCAXWVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.2C4H10N2/c1-2-8-5-3-7(1)4-6-8;2*1-2-6-4-3-5-1/h1-6H2;2*5-6H,1-4H2.
What are the key properties of 1,4-diazabicyclo[2.2.2]octane;piperazine?
1,4-diazabicyclo[2.2.2]octane;piperazine has a molecular weight of 284.45 g/mol, XLogP of -2.02, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[2.2.2]octane;piperazine is sourced from PubChem (CID 67824400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).