C10H9ClN6O3 — CID 67824638
7-[[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]methyl]-1-methyl-3H-purine-2,6-dione (PubChem CID 67824638) has the molecular formula C10H9ClN6O3 and a molecular weight of 296.67 g/mol. Its IUPAC name is 7-[[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]methyl]-1-methyl-3H-purine-2,6-dione.
| Compound Name | 7-[[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]methyl]-1-methyl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 67824638 |
| Molecular Formula | C10H9ClN6O3 |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 7-[[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]methyl]-1-methyl-3H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c2ncn(Cc3noc(CCl)n3)c2c1=O |
| InChI | InChI=1S/C10H9ClN6O3/c1-16-9(18)7-8(14-10(16)19)12-4-17(7)3-5-13-6(2-11)20-15-5/h4H,2-3H2,1H3,(H,14,19) |
| InChIKey | RAKKYJDFQYHEAK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|