C10H11ClN6O3 — CID 67824643
7-[[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]methyl]-9-methyl-3,8-dihydropurine-2,6-dione (PubChem CID 67824643) has the molecular formula C10H11ClN6O3 and a molecular weight of 298.69 g/mol. Its IUPAC name is 7-[[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]methyl]-9-methyl-3,8-dihydropurine-2,6-dione.
| Compound Name | 7-[[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]methyl]-9-methyl-3,8-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 67824643 |
| Molecular Formula | C10H11ClN6O3 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 7-[[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]methyl]-9-methyl-3,8-dihydropurine-2,6-dione |
| SMILES | CN1CN(Cc2noc(CCl)n2)c2c1[nH]c(=O)[nH]c2=O |
| InChI | InChI=1S/C10H11ClN6O3/c1-16-4-17(3-5-12-6(2-11)20-15-5)7-8(16)13-10(19)14-9(7)18/h2-4H2,1H3,(H2,13,14,18,19) |
| InChIKey | UWROCIWEXIMEEB-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|