C18H12I4O6 — CID 67824936
(E)-2,3-bis[(2-hydroxy-3,5-diiodophenyl)methyl]but-2-enedioic acid (PubChem CID 67824936) has the molecular formula C18H12I4O6 and a molecular weight of 831.90 g/mol. Its IUPAC name is (E)-2,3-bis[(2-hydroxy-3,5-diiodophenyl)methyl]but-2-enedioic acid.
| Compound Name | (E)-2,3-bis[(2-hydroxy-3,5-diiodophenyl)methyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 67824936 |
| Molecular Formula | C18H12I4O6 |
| Molecular Weight | 831.90 g/mol |
| Exact Mass | 831.68 |
| IUPAC Name | (E)-2,3-bis[(2-hydroxy-3,5-diiodophenyl)methyl]but-2-enedioic acid |
| SMILES | O=C(O)/C(Cc1cc(I)cc(I)c1O)=C(\Cc1cc(I)cc(I)c1O)C(=O)O |
| InChI | InChI=1S/C18H12I4O6/c19-9-1-7(15(23)13(21)5-9)3-11(17(25)26)12(18(27)28)4-8-2-10(20)6-14(22)16(8)24/h1-2,5-6,23-24H,3-4H2,(H,25,26)(H,27,28)/b12-11+ |
| InChIKey | YBOXUNUUUNLNPG-VAWYXSNFSA-N |
| XLogP | 4.77 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|